About 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane
2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane (PubChem CID 151298833) has the molecular formula C33H38O5
and a molecular weight of 514.66 g/mol. Its IUPAC name is 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane.
Molecular Properties
| Compound Name | 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane |
| PubChem CID | 151298833 |
| Molecular Formula | C33H38O5 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane |
| SMILES | CCC(=C(c1ccc(OCCCC2OCCO2)cc1)c1ccc(OC2CCCCO2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H38O5/c1-2-30(25-9-4-3-5-10-25)33(27-15-19-29(20-16-27)38-32-11-6-7-21-35-32)26-13-17-28(18-14-26)34-22-8-12-31-36-23-24-37-31/h3-5,9-10,13-20,31-32H,2,6-8,11-12,21-24H2,1H3 |
| InChIKey | OBZLKSHBNYZFSX-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane?
The IUPAC name of 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane (CID 151298833) is 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane.
What is the SMILES notation for 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane?
The canonical SMILES for 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane is CCC(=C(c1ccc(OCCCC2OCCO2)cc1)c1ccc(OC2CCCCO2)cc1)c1ccccc1.
What is the InChIKey of 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane?
The InChIKey is OBZLKSHBNYZFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H38O5/c1-2-30(25-9-4-3-5-10-25)33(27-15-19-29(20-16-27)38-32-11-6-7-21-35-32)26-13-17-28(18-14-26)34-22-8-12-31-36-23-24-37-31/h3-5,9-10,13-20,31-32H,2,6-8,11-12,21-24H2,1H3.
What are the key properties of 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane?
2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane has a molecular weight of 514.66 g/mol, XLogP of 7.49, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[1-[4-[3-(1,3-dioxolan-2-yl)propoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]oxane is sourced from PubChem (CID 151298833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).