C19H17N5O — CID 151311241
4-[3-(3-cyanophenyl)-2-pyridinyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile (PubChem CID 151311241) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-[3-(3-cyanophenyl)-2-pyridinyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile.
| Compound Name | 4-[3-(3-cyanophenyl)-2-pyridinyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile |
|---|---|
| PubChem CID | 151311241 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-[3-(3-cyanophenyl)-2-pyridinyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile |
| SMILES | N#Cc1cccc(-c2cccnc2N2CCOC3CN(C#N)CC32)c1 |
| InChI | InChI=1S/C19H17N5O/c20-10-14-3-1-4-15(9-14)16-5-2-6-22-19(16)24-7-8-25-18-12-23(13-21)11-17(18)24/h1-6,9,17-18H,7-8,11-12H2 |
| InChIKey | OEMBEBBVERQEKM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|