C19H18N6 — CID 175561345
(3aR)-2-[5-(3-cyanophenyl)pyrimidin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbonitrile (PubChem CID 175561345) has the molecular formula C19H18N6 and a molecular weight of 330.39 g/mol. Its IUPAC name is (3aR)-2-[5-(3-cyanophenyl)pyrimidin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbonitrile.
| Compound Name | (3aR)-2-[5-(3-cyanophenyl)pyrimidin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 175561345 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (3aR)-2-[5-(3-cyanophenyl)pyrimidin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbonitrile |
| SMILES | N#Cc1cccc(-c2cnc(N3CC4CCN(C#N)C[C@@H]4C3)nc2)c1 |
| InChI | InChI=1S/C19H18N6/c20-7-14-2-1-3-15(6-14)17-8-22-19(23-9-17)25-11-16-4-5-24(13-21)10-18(16)12-25/h1-3,6,8-9,16,18H,4-5,10-12H2/t16?,18-/m1/s1 |
| InChIKey | BMIJTSHRMKGKMO-UHUGOGIASA-N |
| XLogP | 2.25 |
| TPSA | 79.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|