C19H17N7O — CID 156534577
2-[6-(3-cyanophenyl)pyrimidin-4-yl]-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile (PubChem CID 156534577) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-[6-(3-cyanophenyl)pyrimidin-4-yl]-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile.
| Compound Name | 2-[6-(3-cyanophenyl)pyrimidin-4-yl]-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
|---|---|
| PubChem CID | 156534577 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[6-(3-cyanophenyl)pyrimidin-4-yl]-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
| SMILES | N#Cc1cccc(-c2cc(N3CCN4CCN(C#N)CC4C3=O)ncn2)c1 |
| InChI | InChI=1S/C19H17N7O/c20-10-14-2-1-3-15(8-14)16-9-18(23-13-22-16)26-7-6-25-5-4-24(12-21)11-17(25)19(26)27/h1-3,8-9,13,17H,4-7,11H2 |
| InChIKey | JJGBYDKAIMBJTH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|