C15H15F3N4O — CID 156534665
(9aR)-1-oxo-2-[3-(trifluoromethyl)phenyl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile (PubChem CID 156534665) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is (9aR)-1-oxo-2-[3-(trifluoromethyl)phenyl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile.
| Compound Name | (9aR)-1-oxo-2-[3-(trifluoromethyl)phenyl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
|---|---|
| PubChem CID | 156534665 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (9aR)-1-oxo-2-[3-(trifluoromethyl)phenyl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
| SMILES | N#CN1CCN2CCN(c3cccc(C(F)(F)F)c3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C15H15F3N4O/c16-15(17,18)11-2-1-3-12(8-11)22-7-6-21-5-4-20(10-19)9-13(21)14(22)23/h1-3,8,13H,4-7,9H2/t13-/m1/s1 |
| InChIKey | XYXRNPXDLOYWRU-CYBMUJFWSA-N |
| XLogP | 1.52 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|