C19H20F2O — CID 15133048
2-[bis(4-fluorophenyl)methylidene]-3,3-dimethylbutan-1-ol (PubChem CID 15133048) has the molecular formula C19H20F2O and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methylidene]-3,3-dimethylbutan-1-ol.
| Compound Name | 2-[bis(4-fluorophenyl)methylidene]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 15133048 |
| Molecular Formula | C19H20F2O |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methylidene]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(C)C(CO)=C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20F2O/c1-19(2,3)17(12-22)18(13-4-8-15(20)9-5-13)14-6-10-16(21)11-7-14/h4-11,22H,12H2,1-3H3 |
| InChIKey | CMFMQGUPRKROKA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |