C16H11NOS — CID 151342567
2-(9H-fluoren-1-yl)-1,2-thiazol-3-one (PubChem CID 151342567) has the molecular formula C16H11NOS and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-(9H-fluoren-1-yl)-1,2-thiazol-3-one.
| Compound Name | 2-(9H-fluoren-1-yl)-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 151342567 |
| Molecular Formula | C16H11NOS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-(9H-fluoren-1-yl)-1,2-thiazol-3-one |
| SMILES | O=c1ccsn1-c1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C16H11NOS/c18-16-8-9-19-17(16)15-7-3-6-13-12-5-2-1-4-11(12)10-14(13)15/h1-9H,10H2 |
| InChIKey | OKUCTJGSIDWLJM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |