C20H24BrF3N6O — CID 151345753
2-[4-bromo-3-(trifluoromethyl)phenyl]-N-[5-[4-(2-ethylhydrazinyl)piperazin-1-yl]-2-pyridinyl]acetamide (PubChem CID 151345753) has the molecular formula C20H24BrF3N6O and a molecular weight of 501.35 g/mol. Its IUPAC name is 2-[4-bromo-3-(trifluoromethyl)phenyl]-N-[5-[4-(2-ethylhydrazinyl)piperazin-1-yl]-2-pyridinyl]acetamide.
| Compound Name | 2-[4-bromo-3-(trifluoromethyl)phenyl]-N-[5-[4-(2-ethylhydrazinyl)piperazin-1-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 151345753 |
| Molecular Formula | C20H24BrF3N6O |
| Molecular Weight | 501.35 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 2-[4-bromo-3-(trifluoromethyl)phenyl]-N-[5-[4-(2-ethylhydrazinyl)piperazin-1-yl]-2-pyridinyl]acetamide |
| SMILES | CCNNN1CCN(c2ccc(NC(=O)Cc3ccc(Br)c(C(F)(F)F)c3)nc2)CC1 |
| InChI | InChI=1S/C20H24BrF3N6O/c1-2-26-28-30-9-7-29(8-10-30)15-4-6-18(25-13-15)27-19(31)12-14-3-5-17(21)16(11-14)20(22,23)24/h3-6,11,13,26,28H,2,7-10,12H2,1H3,(H,25,27,31) |
| InChIKey | OLKQXTDRZCTXDX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|