C23H25FN4O2 — CID 91261935
N-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]-2-(4-buta-1,3-dien-2-yl-3-fluorophenyl)acetamide (PubChem CID 91261935) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]-2-(4-buta-1,3-dien-2-yl-3-fluorophenyl)acetamide.
| Compound Name | N-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]-2-(4-buta-1,3-dien-2-yl-3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 91261935 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[5-(4-acetylpiperazin-1-yl)-2-pyridinyl]-2-(4-buta-1,3-dien-2-yl-3-fluorophenyl)acetamide |
| SMILES | C=CC(=C)c1ccc(CC(=O)Nc2ccc(N3CCN(C(C)=O)CC3)cn2)cc1F |
| InChI | InChI=1S/C23H25FN4O2/c1-4-16(2)20-7-5-18(13-21(20)24)14-23(30)26-22-8-6-19(15-25-22)28-11-9-27(10-12-28)17(3)29/h4-8,13,15H,1-2,9-12,14H2,3H3,(H,25,26,30) |
| InChIKey | NSEBJDCTRLHJQJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|