C14H21F7O — CID 151364459
1-[1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-enoxy]decane (PubChem CID 151364459) has the molecular formula C14H21F7O and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-[1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-enoxy]decane.
| Compound Name | 1-[1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-enoxy]decane |
|---|---|
| PubChem CID | 151364459 |
| Molecular Formula | C14H21F7O |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-[1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-enoxy]decane |
| SMILES | CCCCCCCCCCOC(F)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H21F7O/c1-2-3-4-5-6-7-8-9-10-22-12(15)11(13(16,17)18)14(19,20)21/h2-10H2,1H3 |
| InChIKey | OPDFQBIUQRNPOG-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|