C10H12N4O2 — CID 151380266
2-morpholin-4-yl-5,7-dihydropyrrolo[3,2-d]pyrimidin-6-one (PubChem CID 151380266) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-morpholin-4-yl-5,7-dihydropyrrolo[3,2-d]pyrimidin-6-one.
| Compound Name | 2-morpholin-4-yl-5,7-dihydropyrrolo[3,2-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 151380266 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-morpholin-4-yl-5,7-dihydropyrrolo[3,2-d]pyrimidin-6-one |
| SMILES | O=C1Cc2nc(N3CCOCC3)ncc2N1 |
| InChI | InChI=1S/C10H12N4O2/c15-9-5-7-8(12-9)6-11-10(13-7)14-1-3-16-4-2-14/h6H,1-5H2,(H,12,15) |
| InChIKey | OSGQCPCVCDINFQ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |