C21H25BrN2O4S — CID 151395000
tert-butyl N-(1-benzylsulfonyl-7-bromo-3,4-dihydro-2H-quinolin-4-yl)carbamate (PubChem CID 151395000) has the molecular formula C21H25BrN2O4S and a molecular weight of 481.41 g/mol. Its IUPAC name is tert-butyl N-(1-benzylsulfonyl-7-bromo-3,4-dihydro-2H-quinolin-4-yl)carbamate.
| Compound Name | tert-butyl N-(1-benzylsulfonyl-7-bromo-3,4-dihydro-2H-quinolin-4-yl)carbamate |
|---|---|
| PubChem CID | 151395000 |
| Molecular Formula | C21H25BrN2O4S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | tert-butyl N-(1-benzylsulfonyl-7-bromo-3,4-dihydro-2H-quinolin-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)Cc2ccccc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C21H25BrN2O4S/c1-21(2,3)28-20(25)23-18-11-12-24(19-13-16(22)9-10-17(18)19)29(26,27)14-15-7-5-4-6-8-15/h4-10,13,18H,11-12,14H2,1-3H3,(H,23,25) |
| InChIKey | OVGGRQBRBXUZAZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |