C15H15FN4O — CID 151407964
4-(4-fluorophenyl)-1-methyl-5-[(2-methyl-2H-pyrrol-5-yl)oxymethyl]triazole (PubChem CID 151407964) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-methyl-5-[(2-methyl-2H-pyrrol-5-yl)oxymethyl]triazole.
| Compound Name | 4-(4-fluorophenyl)-1-methyl-5-[(2-methyl-2H-pyrrol-5-yl)oxymethyl]triazole |
|---|---|
| PubChem CID | 151407964 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-(4-fluorophenyl)-1-methyl-5-[(2-methyl-2H-pyrrol-5-yl)oxymethyl]triazole |
| SMILES | CC1C=CC(OCc2c(-c3ccc(F)cc3)nnn2C)=N1 |
| InChI | InChI=1S/C15H15FN4O/c1-10-3-8-14(17-10)21-9-13-15(18-19-20(13)2)11-4-6-12(16)7-5-11/h3-8,10H,9H2,1-2H3 |
| InChIKey | OXXBEKSFCFJMKY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |