C11H27NO3Si2 — CID 151410719
[methoxy-[6-(methoxymethyl)-2,2-dimethyl-1,4,2-oxazasilinan-4-yl]methyl]-dimethylsilane (PubChem CID 151410719) has the molecular formula C11H27NO3Si2 and a molecular weight of 277.51 g/mol. Its IUPAC name is [methoxy-[6-(methoxymethyl)-2,2-dimethyl-1,4,2-oxazasilinan-4-yl]methyl]-dimethylsilane.
| Compound Name | [methoxy-[6-(methoxymethyl)-2,2-dimethyl-1,4,2-oxazasilinan-4-yl]methyl]-dimethylsilane |
|---|---|
| PubChem CID | 151410719 |
| Molecular Formula | C11H27NO3Si2 |
| Molecular Weight | 277.51 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [methoxy-[6-(methoxymethyl)-2,2-dimethyl-1,4,2-oxazasilinan-4-yl]methyl]-dimethylsilane |
| SMILES | COCC1CN(C(OC)[SiH](C)C)C[Si](C)(C)O1 |
| InChI | InChI=1S/C11H27NO3Si2/c1-13-8-10-7-12(9-17(5,6)15-10)11(14-2)16(3)4/h10-11,16H,7-9H2,1-6H3 |
| InChIKey | OYLRCGRIOSBELU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.51 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|