About CID 153300883
CID 153300883 (PubChem CID 153300883) has the molecular formula C15H34NO3Si2
and a molecular weight of 332.61 g/mol.
Molecular Properties
| Compound Name | CID 153300883 |
| PubChem CID | 153300883 |
| Molecular Formula | C15H34NO3Si2 |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | — |
| SMILES | COCC1CN(CCC(OC)[Si](C)C)CCC[Si](C)(C)O1 |
| InChI | InChI=1S/C15H34NO3Si2/c1-17-13-14-12-16(9-7-11-21(5,6)19-14)10-8-15(18-2)20(3)4/h14-15H,7-13H2,1-6H3 |
| InChIKey | LGMOKHXSBBFPOV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153300883 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153300883?
The IUPAC name of CID 153300883 (CID 153300883) is not available.
What is the SMILES notation for CID 153300883?
The canonical SMILES for CID 153300883 is COCC1CN(CCC(OC)[Si](C)C)CCC[Si](C)(C)O1.
What is the InChIKey of CID 153300883?
The InChIKey is LGMOKHXSBBFPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H34NO3Si2/c1-17-13-14-12-16(9-7-11-21(5,6)19-14)10-8-15(18-2)20(3)4/h14-15H,7-13H2,1-6H3.
What are the key properties of CID 153300883?
CID 153300883 has a molecular weight of 332.61 g/mol, XLogP of 2.63, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153300883 is sourced from PubChem (CID 153300883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).