C45H100N4O12Si8 — CID 177302436
CID 177302436 (PubChem CID 177302436) has the molecular formula C45H100N4O12Si8 and a molecular weight of 1114.00 g/mol.
| Compound Name | CID 177302436 |
|---|---|
| PubChem CID | 177302436 |
| Molecular Formula | C45H100N4O12Si8 |
| Molecular Weight | 1114.00 g/mol |
| Exact Mass | 1112.55 |
| IUPAC Name | — |
| SMILES | COC(N1CC(COCC(COCC2CN(C(OC)[Si](C)C)C[Si](C)(C)O2)(COCC2CN(C(OC)[Si](C)C)C[Si](C)(C)O2)COCC2CN(C(OC)[Si](C)C)C[Si](C)(C)O2)O[Si](C)(C)C1)[Si](C)C |
| InChI | InChI=1S/C45H100N4O12Si8/c1-50-41(62(5)6)46-21-37(58-66(13,14)33-46)25-54-29-45(30-55-26-38-22-47(34-67(15,16)59-38)42(51-2)63(7)8,31-56-27-39-23-48(35-68(17,18)60-39)43(52-3)64(9)10)32-57-28-40-24-49(36-69(19,20)61-40)44(53-4)65(11)12/h37-44H,21-36H2,1-20H3 |
| InChIKey | NRAJFQMWLYJTQI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 123.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1114.00 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|