C19H33NO7Si — CID 20682611
1-methoxy-3,7,10-tris(prop-2-enoxymethyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane (PubChem CID 20682611) has the molecular formula C19H33NO7Si and a molecular weight of 415.56 g/mol. Its IUPAC name is 1-methoxy-3,7,10-tris(prop-2-enoxymethyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane.
| Compound Name | 1-methoxy-3,7,10-tris(prop-2-enoxymethyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 20682611 |
| Molecular Formula | C19H33NO7Si |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-methoxy-3,7,10-tris(prop-2-enoxymethyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
| SMILES | C=CCOCC1CN2CC(COCC=C)O[Si](OC)(O1)OC(COCC=C)C2 |
| InChI | InChI=1S/C19H33NO7Si/c1-5-8-22-14-17-11-20-12-18(15-23-9-6-2)26-28(21-4,25-17)27-19(13-20)16-24-10-7-3/h5-7,17-19H,1-3,8-16H2,4H3 |
| InChIKey | NIWZKWQNWNPZIF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|