C15H33NO8Si2 — CID 18730818
trimethoxy-[3-[(1-methoxy-7-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl)methoxy]propyl]silane (PubChem CID 18730818) has the molecular formula C15H33NO8Si2 and a molecular weight of 411.60 g/mol. Its IUPAC name is trimethoxy-[3-[(1-methoxy-7-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl)methoxy]propyl]silane.
| Compound Name | trimethoxy-[3-[(1-methoxy-7-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl)methoxy]propyl]silane |
|---|---|
| PubChem CID | 18730818 |
| Molecular Formula | C15H33NO8Si2 |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | trimethoxy-[3-[(1-methoxy-7-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl)methoxy]propyl]silane |
| SMILES | CO[Si](CCCOCC1CN2CCO[Si](OC)(OC(C)C2)O1)(OC)OC |
| InChI | InChI=1S/C15H33NO8Si2/c1-14-11-16-7-9-22-26(20-5,23-14)24-15(12-16)13-21-8-6-10-25(17-2,18-3)19-4/h14-15H,6-13H2,1-5H3 |
| InChIKey | JVDASUANMOQCGC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 77.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|