C20H43NO8Si2 — CID 59936782
triethoxy-[3-[(1-ethoxy-7,10-dimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl)methoxy]propyl]silane (PubChem CID 59936782) has the molecular formula C20H43NO8Si2 and a molecular weight of 481.74 g/mol. Its IUPAC name is triethoxy-[3-[(1-ethoxy-7,10-dimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl)methoxy]propyl]silane.
| Compound Name | triethoxy-[3-[(1-ethoxy-7,10-dimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl)methoxy]propyl]silane |
|---|---|
| PubChem CID | 59936782 |
| Molecular Formula | C20H43NO8Si2 |
| Molecular Weight | 481.74 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | triethoxy-[3-[(1-ethoxy-7,10-dimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl)methoxy]propyl]silane |
| SMILES | CCO[Si](CCCOCC1CN2CC(C)O[Si](OCC)(OC(C)C2)O1)(OCC)OCC |
| InChI | InChI=1S/C20H43NO8Si2/c1-7-23-30(24-8-2,25-9-3)13-11-12-22-17-20-16-21-14-18(5)27-31(29-20,26-10-4)28-19(6)15-21/h18-20H,7-17H2,1-6H3 |
| InChIKey | DSMKHYKTOFWALS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|