C32H72N2O14Si4 — CID 177302447
[6-[2-[[2,2-diethoxy-4-(triethoxysilylmethyl)-1,4,2-oxazasilinan-6-yl]methoxy]ethoxymethyl]-2,2-diethoxy-1,4,2-oxazasilinan-4-yl]methyl-triethoxysilane (PubChem CID 177302447) has the molecular formula C32H72N2O14Si4 and a molecular weight of 821.27 g/mol. Its IUPAC name is [6-[2-[[2,2-diethoxy-4-(triethoxysilylmethyl)-1,4,2-oxazasilinan-6-yl]methoxy]ethoxymethyl]-2,2-diethoxy-1,4,2-oxazasilinan-4-yl]methyl-triethoxysilane.
| Compound Name | [6-[2-[[2,2-diethoxy-4-(triethoxysilylmethyl)-1,4,2-oxazasilinan-6-yl]methoxy]ethoxymethyl]-2,2-diethoxy-1,4,2-oxazasilinan-4-yl]methyl-triethoxysilane |
|---|---|
| PubChem CID | 177302447 |
| Molecular Formula | C32H72N2O14Si4 |
| Molecular Weight | 821.27 g/mol |
| Exact Mass | 820.41 |
| IUPAC Name | [6-[2-[[2,2-diethoxy-4-(triethoxysilylmethyl)-1,4,2-oxazasilinan-6-yl]methoxy]ethoxymethyl]-2,2-diethoxy-1,4,2-oxazasilinan-4-yl]methyl-triethoxysilane |
| SMILES | CCO[Si](CN1CC(COCCOCC2CN(C[Si](OCC)(OCC)OCC)C[Si](OCC)(OCC)O2)O[Si](OCC)(OCC)C1)(OCC)OCC |
| InChI | InChI=1S/C32H72N2O14Si4/c1-11-37-49(38-12-2,39-13-3)27-33-23-31(47-51(29-33,43-17-7)44-18-8)25-35-21-22-36-26-32-24-34(30-52(48-32,45-19-9)46-20-10)28-50(40-14-4,41-15-5)42-16-6/h31-32H,11-30H2,1-10H3 |
| InChIKey | GIPMHEHSJMGFQB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 135.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|