C42H89N3O15Si6 — CID 177302475
CID 177302475 (PubChem CID 177302475) has the molecular formula C42H89N3O15Si6 and a molecular weight of 1044.70 g/mol.
| Compound Name | CID 177302475 |
|---|---|
| PubChem CID | 177302475 |
| Molecular Formula | C42H89N3O15Si6 |
| Molecular Weight | 1044.70 g/mol |
| Exact Mass | 1043.49 |
| IUPAC Name | — |
| SMILES | CCOC(OCC)[Si]CN1CC(COCC(COCC2CN(C[Si]C(OCC)OCC)C[Si](C)(OCC)O2)OCC2CN(C[Si]C(OCC)OCC)C[Si](C)(OCC)O2)O[Si](C)(OCC)C1 |
| InChI | InChI=1S/C42H89N3O15Si6/c1-13-48-40(49-14-2)61-30-43-22-36(58-64(10,33-43)55-19-7)25-46-27-39(54-29-38-24-45(35-66(12,60-38)57-21-9)32-63-42(52-17-5)53-18-6)28-47-26-37-23-44(34-65(11,59-37)56-20-8)31-62-41(50-15-3)51-16-4/h36-42H,13-35H2,1-12H3 |
| InChIKey | NBLJUTPERSHFRG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 148.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|