About CID 177302488
CID 177302488 (PubChem CID 177302488) has the molecular formula C26H56N2O8Si4
and a molecular weight of 637.08 g/mol.
Molecular Properties
| Compound Name | CID 177302488 |
| PubChem CID | 177302488 |
| Molecular Formula | C26H56N2O8Si4 |
| Molecular Weight | 637.08 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | — |
| SMILES | COC(OC)[Si]CN1CC(CCCCCCC(C)C2CN(C[Si]C(OC)OC)C[Si](C)(OC)O2)O[Si](C)(OC)C1 |
| InChI | InChI=1S/C26H56N2O8Si4/c1-22(24-17-28(19-38-26(31-4)32-5)21-40(9,34-7)36-24)14-12-10-11-13-15-23-16-27(18-37-25(29-2)30-3)20-39(8,33-6)35-23/h22-26H,10-21H2,1-9H3 |
| InChIKey | OZVTYMTXIPRGEJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 637.08 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 177302488 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177302488?
The IUPAC name of CID 177302488 (CID 177302488) is not available.
What is the SMILES notation for CID 177302488?
The canonical SMILES for CID 177302488 is COC(OC)[Si]CN1CC(CCCCCCC(C)C2CN(C[Si]C(OC)OC)C[Si](C)(OC)O2)O[Si](C)(OC)C1.
What is the InChIKey of CID 177302488?
The InChIKey is OZVTYMTXIPRGEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H56N2O8Si4/c1-22(24-17-28(19-38-26(31-4)32-5)21-40(9,34-7)36-24)14-12-10-11-13-15-23-16-27(18-37-25(29-2)30-3)20-39(8,33-6)35-23/h22-26H,10-21H2,1-9H3.
What are the key properties of CID 177302488?
CID 177302488 has a molecular weight of 637.08 g/mol, XLogP of 2.36, 20 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177302488 is sourced from PubChem (CID 177302488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).