About 3,7-bis(1,4-dioxan-2-yl)octan-1-ol
3,7-bis(1,4-dioxan-2-yl)octan-1-ol (PubChem CID 174444862) has the molecular formula C16H30O5
and a molecular weight of 302.41 g/mol. Its IUPAC name is 3,7-bis(1,4-dioxan-2-yl)octan-1-ol.
Molecular Properties
| Compound Name | 3,7-bis(1,4-dioxan-2-yl)octan-1-ol |
| PubChem CID | 174444862 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 3,7-bis(1,4-dioxan-2-yl)octan-1-ol |
| SMILES | CC(CCCC(CCO)C1COCCO1)C1COCCO1 |
| InChI | InChI=1S/C16H30O5/c1-13(15-11-18-7-9-20-15)3-2-4-14(5-6-17)16-12-19-8-10-21-16/h13-17H,2-12H2,1H3 |
| InChIKey | AVFXHBWEMQZNPX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,7-bis(1,4-dioxan-2-yl)octan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-bis(1,4-dioxan-2-yl)octan-1-ol?
The IUPAC name of 3,7-bis(1,4-dioxan-2-yl)octan-1-ol (CID 174444862) is 3,7-bis(1,4-dioxan-2-yl)octan-1-ol.
What is the SMILES notation for 3,7-bis(1,4-dioxan-2-yl)octan-1-ol?
The canonical SMILES for 3,7-bis(1,4-dioxan-2-yl)octan-1-ol is CC(CCCC(CCO)C1COCCO1)C1COCCO1.
What is the InChIKey of 3,7-bis(1,4-dioxan-2-yl)octan-1-ol?
The InChIKey is AVFXHBWEMQZNPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O5/c1-13(15-11-18-7-9-20-15)3-2-4-14(5-6-17)16-12-19-8-10-21-16/h13-17H,2-12H2,1H3.
What are the key properties of 3,7-bis(1,4-dioxan-2-yl)octan-1-ol?
3,7-bis(1,4-dioxan-2-yl)octan-1-ol has a molecular weight of 302.41 g/mol, XLogP of 1.62, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-bis(1,4-dioxan-2-yl)octan-1-ol is sourced from PubChem (CID 174444862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).