About 4-(1,3-dioxolan-2-yl)heptane-1,7-diol
4-(1,3-dioxolan-2-yl)heptane-1,7-diol (PubChem CID 134273656) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)heptane-1,7-diol.
Molecular Properties
| Compound Name | 4-(1,3-dioxolan-2-yl)heptane-1,7-diol |
| PubChem CID | 134273656 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)heptane-1,7-diol |
| SMILES | OCCCC(CCCO)C1OCCO1 |
| InChI | InChI=1S/C10H20O4/c11-5-1-3-9(4-2-6-12)10-13-7-8-14-10/h9-12H,1-8H2 |
| InChIKey | KOSNCRQPMSYLJR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-dioxolan-2-yl)heptane-1,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxolan-2-yl)heptane-1,7-diol?
The IUPAC name of 4-(1,3-dioxolan-2-yl)heptane-1,7-diol (CID 134273656) is 4-(1,3-dioxolan-2-yl)heptane-1,7-diol.
What is the SMILES notation for 4-(1,3-dioxolan-2-yl)heptane-1,7-diol?
The canonical SMILES for 4-(1,3-dioxolan-2-yl)heptane-1,7-diol is OCCCC(CCCO)C1OCCO1.
What is the InChIKey of 4-(1,3-dioxolan-2-yl)heptane-1,7-diol?
The InChIKey is KOSNCRQPMSYLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c11-5-1-3-9(4-2-6-12)10-13-7-8-14-10/h9-12H,1-8H2.
What are the key properties of 4-(1,3-dioxolan-2-yl)heptane-1,7-diol?
4-(1,3-dioxolan-2-yl)heptane-1,7-diol has a molecular weight of 204.27 g/mol, XLogP of 0.52, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxolan-2-yl)heptane-1,7-diol is sourced from PubChem (CID 134273656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).