C7H14O5 — CID 57031981
1-(1,3,5-trioxan-2-yl)butane-1,4-diol (PubChem CID 57031981) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is 1-(1,3,5-trioxan-2-yl)butane-1,4-diol.
| Compound Name | 1-(1,3,5-trioxan-2-yl)butane-1,4-diol |
|---|---|
| PubChem CID | 57031981 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 1-(1,3,5-trioxan-2-yl)butane-1,4-diol |
| SMILES | OCCCC(O)C1OCOCO1 |
| InChI | InChI=1S/C7H14O5/c8-3-1-2-6(9)7-11-4-10-5-12-7/h6-9H,1-5H2 |
| InChIKey | SMKSZPIICVRNAW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |