C5H9ClO3 — CID 82254004
2-chloro-2-(1,3-dioxolan-2-yl)ethanol (PubChem CID 82254004) has the molecular formula C5H9ClO3 and a molecular weight of 152.58 g/mol. Its IUPAC name is 2-chloro-2-(1,3-dioxolan-2-yl)ethanol.
| Compound Name | 2-chloro-2-(1,3-dioxolan-2-yl)ethanol |
|---|---|
| PubChem CID | 82254004 |
| Molecular Formula | C5H9ClO3 |
| Molecular Weight | 152.58 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 2-chloro-2-(1,3-dioxolan-2-yl)ethanol |
| SMILES | OCC(Cl)C1OCCO1 |
| InChI | InChI=1S/C5H9ClO3/c6-4(3-7)5-8-1-2-9-5/h4-5,7H,1-3H2 |
| InChIKey | HTQBVDRVQYYWGM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.58 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|