C9H16Cl2O4 — CID 70638651
4-chloro-4-[4-(2-chloroethyl)-1,3-dioxolan-2-yl]butane-1,2-diol (PubChem CID 70638651) has the molecular formula C9H16Cl2O4 and a molecular weight of 259.13 g/mol. Its IUPAC name is 4-chloro-4-[4-(2-chloroethyl)-1,3-dioxolan-2-yl]butane-1,2-diol.
| Compound Name | 4-chloro-4-[4-(2-chloroethyl)-1,3-dioxolan-2-yl]butane-1,2-diol |
|---|---|
| PubChem CID | 70638651 |
| Molecular Formula | C9H16Cl2O4 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4-chloro-4-[4-(2-chloroethyl)-1,3-dioxolan-2-yl]butane-1,2-diol |
| SMILES | OCC(O)CC(Cl)C1OCC(CCCl)O1 |
| InChI | InChI=1S/C9H16Cl2O4/c10-2-1-7-5-14-9(15-7)8(11)3-6(13)4-12/h6-9,12-13H,1-5H2 |
| InChIKey | ZSYXYJIKSFKHDX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|