C12H22O8 — CID 87308425
2-(oxiran-2-ylmethoxymethyl)oxirane;propane-1,2,3-triol;prop-2-enoic acid (PubChem CID 87308425) has the molecular formula C12H22O8 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;propane-1,2,3-triol;prop-2-enoic acid.
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;propane-1,2,3-triol;prop-2-enoic acid |
|---|---|
| PubChem CID | 87308425 |
| Molecular Formula | C12H22O8 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;propane-1,2,3-triol;prop-2-enoic acid |
| SMILES | C(OCC1CO1)C1CO1.C=CC(=O)O.OCC(O)CO |
| InChI | InChI=1S/C6H10O3.C3H8O3.C3H4O2/c1(5-3-8-5)7-2-6-4-9-6;4-1-3(6)2-5;1-2-3(4)5/h5-6H,1-4H2;3-6H,1-2H2;2H,1H2,(H,4,5) |
| InChIKey | QGRUDDUNPZDPET-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|