C12H23NO5Si — CID 176899824
3,7,10-trimethyl-1-(oxiran-2-ylmethoxy)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane (PubChem CID 176899824) has the molecular formula C12H23NO5Si and a molecular weight of 289.40 g/mol. Its IUPAC name is 3,7,10-trimethyl-1-(oxiran-2-ylmethoxy)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane.
| Compound Name | 3,7,10-trimethyl-1-(oxiran-2-ylmethoxy)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 176899824 |
| Molecular Formula | C12H23NO5Si |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3,7,10-trimethyl-1-(oxiran-2-ylmethoxy)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
| SMILES | CC1CN2CC(C)O[Si](OCC3CO3)(O1)OC(C)C2 |
| InChI | InChI=1S/C12H23NO5Si/c1-9-4-13-5-10(2)17-19(16-9,18-11(3)6-13)15-8-12-7-14-12/h9-12H,4-8H2,1-3H3 |
| InChIKey | WPKQPCVXZZWKJA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 52.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|