C26H52N2O6Si2 — CID 123934634
3,7,10-trimethyl-1-[8-(3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)octyl]-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane (PubChem CID 123934634) has the molecular formula C26H52N2O6Si2 and a molecular weight of 544.88 g/mol. Its IUPAC name is 3,7,10-trimethyl-1-[8-(3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)octyl]-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane.
| Compound Name | 3,7,10-trimethyl-1-[8-(3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)octyl]-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 123934634 |
| Molecular Formula | C26H52N2O6Si2 |
| Molecular Weight | 544.88 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 3,7,10-trimethyl-1-[8-(3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)octyl]-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
| SMILES | CC1CN2CC(C)O[Si](CCCCCCCC[Si]34OC(C)CN(CC(C)O3)CC(C)O4)(O1)OC(C)C2 |
| InChI | InChI=1S/C26H52N2O6Si2/c1-21-15-27-16-22(2)30-35(29-21,31-23(3)17-27)13-11-9-7-8-10-12-14-36-32-24(4)18-28(19-25(5)33-36)20-26(6)34-36/h21-26H,7-20H2,1-6H3 |
| InChIKey | RZDLBBALPCDJKL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|