C11H22O6Si — CID 140868968
3-[3-(3,5-dimethyl-2,6,7-trioxa-1-silabicyclo[2.2.1]heptan-1-yl)propoxy]propane-1,2-diol (PubChem CID 140868968) has the molecular formula C11H22O6Si and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-[3-(3,5-dimethyl-2,6,7-trioxa-1-silabicyclo[2.2.1]heptan-1-yl)propoxy]propane-1,2-diol.
| Compound Name | 3-[3-(3,5-dimethyl-2,6,7-trioxa-1-silabicyclo[2.2.1]heptan-1-yl)propoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 140868968 |
| Molecular Formula | C11H22O6Si |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-[3-(3,5-dimethyl-2,6,7-trioxa-1-silabicyclo[2.2.1]heptan-1-yl)propoxy]propane-1,2-diol |
| SMILES | CC1O[Si]2(CCCOCC(O)CO)OC(C)C1O2 |
| InChI | InChI=1S/C11H22O6Si/c1-8-11-9(2)16-18(15-8,17-11)5-3-4-14-7-10(13)6-12/h8-13H,3-7H2,1-2H3 |
| InChIKey | ZDYCBIIFDRGCFW-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|