C9H24O4Si2 — CID 123241987
3-(3-trimethylsilyloxysilylpropoxy)propane-1,2-diol (PubChem CID 123241987) has the molecular formula C9H24O4Si2 and a molecular weight of 252.46 g/mol. Its IUPAC name is 3-(3-trimethylsilyloxysilylpropoxy)propane-1,2-diol.
| Compound Name | 3-(3-trimethylsilyloxysilylpropoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 123241987 |
| Molecular Formula | C9H24O4Si2 |
| Molecular Weight | 252.46 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-(3-trimethylsilyloxysilylpropoxy)propane-1,2-diol |
| SMILES | C[Si](C)(C)O[SiH2]CCCOCC(O)CO |
| InChI | InChI=1S/C9H24O4Si2/c1-15(2,3)13-14-6-4-5-12-8-9(11)7-10/h9-11H,4-8,14H2,1-3H3 |
| InChIKey | PZCKYCWQKHVZGQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.46 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|