C13H34O5Si3 — CID 173060543
3-[3-[bis(trimethylsilyloxy)methylsilyl]propoxy]propane-1,2-diol (PubChem CID 173060543) has the molecular formula C13H34O5Si3 and a molecular weight of 354.67 g/mol. Its IUPAC name is 3-[3-[bis(trimethylsilyloxy)methylsilyl]propoxy]propane-1,2-diol.
| Compound Name | 3-[3-[bis(trimethylsilyloxy)methylsilyl]propoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 173060543 |
| Molecular Formula | C13H34O5Si3 |
| Molecular Weight | 354.67 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-[3-[bis(trimethylsilyloxy)methylsilyl]propoxy]propane-1,2-diol |
| SMILES | C[Si](C)(C)OC(O[Si](C)(C)C)[SiH2]CCCOCC(O)CO |
| InChI | InChI=1S/C13H34O5Si3/c1-20(2,3)17-13(18-21(4,5)6)19-9-7-8-16-11-12(15)10-14/h12-15H,7-11,19H2,1-6H3 |
| InChIKey | AGSFREYNYHIPLJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.67 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|