C17H39NO5Si3 — CID 154382403
6-[3-[bis(trimethylsilyloxy)methylsilyl]propoxy]-5-hydroxy-2-methylhex-2-enamide (PubChem CID 154382403) has the molecular formula C17H39NO5Si3 and a molecular weight of 421.76 g/mol. Its IUPAC name is 6-[3-[bis(trimethylsilyloxy)methylsilyl]propoxy]-5-hydroxy-2-methylhex-2-enamide.
| Compound Name | 6-[3-[bis(trimethylsilyloxy)methylsilyl]propoxy]-5-hydroxy-2-methylhex-2-enamide |
|---|---|
| PubChem CID | 154382403 |
| Molecular Formula | C17H39NO5Si3 |
| Molecular Weight | 421.76 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 6-[3-[bis(trimethylsilyloxy)methylsilyl]propoxy]-5-hydroxy-2-methylhex-2-enamide |
| SMILES | CC(=CCC(O)COCCC[SiH2]C(O[Si](C)(C)C)O[Si](C)(C)C)C(N)=O |
| InChI | InChI=1S/C17H39NO5Si3/c1-14(16(18)20)9-10-15(19)13-21-11-8-12-24-17(22-25(2,3)4)23-26(5,6)7/h9,15,17,19H,8,10-13,24H2,1-7H3,(H2,18,20) |
| InChIKey | ZPHDOPHUPUTIOO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|