C28H59NO5Si2 — CID 141267898
6-[3-[tert-butyl(dimethyl)silyl]propoxy]-3-[3-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-hydroxypropyl]-5-hydroxy-2-methylhex-2-enamide (PubChem CID 141267898) has the molecular formula C28H59NO5Si2 and a molecular weight of 545.95 g/mol. Its IUPAC name is 6-[3-[tert-butyl(dimethyl)silyl]propoxy]-3-[3-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-hydroxypropyl]-5-hydroxy-2-methylhex-2-enamide.
| Compound Name | 6-[3-[tert-butyl(dimethyl)silyl]propoxy]-3-[3-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-hydroxypropyl]-5-hydroxy-2-methylhex-2-enamide |
|---|---|
| PubChem CID | 141267898 |
| Molecular Formula | C28H59NO5Si2 |
| Molecular Weight | 545.95 g/mol |
| Exact Mass | 545.39 |
| IUPAC Name | 6-[3-[tert-butyl(dimethyl)silyl]propoxy]-3-[3-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-hydroxypropyl]-5-hydroxy-2-methylhex-2-enamide |
| SMILES | CC(C(N)=O)=C(CC(O)COCCC[Si](C)(C)C(C)(C)C)CC(O)COCCC[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H59NO5Si2/c1-22(26(29)32)23(18-24(30)20-33-14-12-16-35(8,9)27(2,3)4)19-25(31)21-34-15-13-17-36(10,11)28(5,6)7/h24-25,30-31H,12-21H2,1-11H3,(H2,29,32) |
| InChIKey | JVIIJQMZPKESHM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.95 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|