C29H61NO8Si2 — CID 123244643
2-[4-[2-[3-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]propyl-dimethylsilyl]propan-2-yloxy-dimethylsilyl]-4-methylpentoxy]ethyl 2-methylprop-2-enoate (PubChem CID 123244643) has the molecular formula C29H61NO8Si2 and a molecular weight of 607.98 g/mol. Its IUPAC name is 2-[4-[2-[3-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]propyl-dimethylsilyl]propan-2-yloxy-dimethylsilyl]-4-methylpentoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2-[3-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]propyl-dimethylsilyl]propan-2-yloxy-dimethylsilyl]-4-methylpentoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123244643 |
| Molecular Formula | C29H61NO8Si2 |
| Molecular Weight | 607.98 g/mol |
| Exact Mass | 607.39 |
| IUPAC Name | 2-[4-[2-[3-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]propyl-dimethylsilyl]propan-2-yloxy-dimethylsilyl]-4-methylpentoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCCC(C)(C)[Si](C)(C)OC(C)(C)[Si](C)(C)CCCOCC(O)CN(CCO)CCO |
| InChI | InChI=1S/C29H61NO8Si2/c1-25(2)27(34)37-21-20-35-18-11-13-28(3,4)40(9,10)38-29(5,6)39(7,8)22-12-19-36-24-26(33)23-30(14-16-31)15-17-32/h26,31-33H,1,11-24H2,2-10H3 |
| InChIKey | RIPHMHNLVGOLBO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.98 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|