C27H57NO5Si2 — CID 173055573
6-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-[3-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-hydroxypropyl]-5-hydroxyhex-2-enamide (PubChem CID 173055573) has the molecular formula C27H57NO5Si2 and a molecular weight of 531.93 g/mol. Its IUPAC name is 6-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-[3-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-hydroxypropyl]-5-hydroxyhex-2-enamide.
| Compound Name | 6-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-[3-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-hydroxypropyl]-5-hydroxyhex-2-enamide |
|---|---|
| PubChem CID | 173055573 |
| Molecular Formula | C27H57NO5Si2 |
| Molecular Weight | 531.93 g/mol |
| Exact Mass | 531.38 |
| IUPAC Name | 6-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-[3-[3-[tert-butyl(dimethyl)silyl]propoxy]-2-hydroxypropyl]-5-hydroxyhex-2-enamide |
| SMILES | CC(C)(C)[Si](C)(C)CCCOCC(O)CC=C(CC(O)COCCC[Si](C)(C)C(C)(C)C)C(N)=O |
| InChI | InChI=1S/C27H57NO5Si2/c1-26(2,3)34(7,8)17-11-15-32-20-23(29)14-13-22(25(28)31)19-24(30)21-33-16-12-18-35(9,10)27(4,5)6/h13,23-24,29-30H,11-12,14-21H2,1-10H3,(H2,28,31) |
| InChIKey | CGXUHVQKDVTRIY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.93 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|