C16H31NO7Si — CID 58903407
[2-hydroxy-3-(3-trimethoxysilylpropoxy)propyl] 4-cyano-4-methylpentanoate (PubChem CID 58903407) has the molecular formula C16H31NO7Si and a molecular weight of 377.51 g/mol. Its IUPAC name is [2-hydroxy-3-(3-trimethoxysilylpropoxy)propyl] 4-cyano-4-methylpentanoate.
| Compound Name | [2-hydroxy-3-(3-trimethoxysilylpropoxy)propyl] 4-cyano-4-methylpentanoate |
|---|---|
| PubChem CID | 58903407 |
| Molecular Formula | C16H31NO7Si |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [2-hydroxy-3-(3-trimethoxysilylpropoxy)propyl] 4-cyano-4-methylpentanoate |
| SMILES | CO[Si](CCCOCC(O)COC(=O)CCC(C)(C)C#N)(OC)OC |
| InChI | InChI=1S/C16H31NO7Si/c1-16(2,13-17)8-7-15(19)24-12-14(18)11-23-9-6-10-25(20-3,21-4)22-5/h14,18H,6-12H2,1-5H3 |
| InChIKey | GRGLYWQCTRCLBM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|