C16H38O3Si2 — CID 123271869
2,3,3-trimethyl-2-propan-2-yl-1-(3-trimethylsilyloxysilylpropoxy)butan-1-ol (PubChem CID 123271869) has the molecular formula C16H38O3Si2 and a molecular weight of 334.65 g/mol. Its IUPAC name is 2,3,3-trimethyl-2-propan-2-yl-1-(3-trimethylsilyloxysilylpropoxy)butan-1-ol.
| Compound Name | 2,3,3-trimethyl-2-propan-2-yl-1-(3-trimethylsilyloxysilylpropoxy)butan-1-ol |
|---|---|
| PubChem CID | 123271869 |
| Molecular Formula | C16H38O3Si2 |
| Molecular Weight | 334.65 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 2,3,3-trimethyl-2-propan-2-yl-1-(3-trimethylsilyloxysilylpropoxy)butan-1-ol |
| SMILES | CC(C)C(C)(C(O)OCCC[SiH2]O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H38O3Si2/c1-13(2)16(6,15(3,4)5)14(17)18-11-10-12-20-19-21(7,8)9/h13-14,17H,10-12,20H2,1-9H3 |
| InChIKey | WXJGJLJXZVWWBF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|