C13H26O2 — CID 91316021
1-but-3-enoxy-2,2,4,4-tetramethylpentan-1-ol (PubChem CID 91316021) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-but-3-enoxy-2,2,4,4-tetramethylpentan-1-ol.
| Compound Name | 1-but-3-enoxy-2,2,4,4-tetramethylpentan-1-ol |
|---|---|
| PubChem CID | 91316021 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 1-but-3-enoxy-2,2,4,4-tetramethylpentan-1-ol |
| SMILES | C=CCCOC(O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C13H26O2/c1-7-8-9-15-11(14)13(5,6)10-12(2,3)4/h7,11,14H,1,8-10H2,2-6H3 |
| InChIKey | ZZPMGLOABWYMOO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|