C15H30O2 — CID 123883784
2-butan-2-yl-2,4,4-trimethyl-1-prop-2-enoxypentan-1-ol (PubChem CID 123883784) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 2-butan-2-yl-2,4,4-trimethyl-1-prop-2-enoxypentan-1-ol.
| Compound Name | 2-butan-2-yl-2,4,4-trimethyl-1-prop-2-enoxypentan-1-ol |
|---|---|
| PubChem CID | 123883784 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 2-butan-2-yl-2,4,4-trimethyl-1-prop-2-enoxypentan-1-ol |
| SMILES | C=CCOC(O)C(C)(CC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C15H30O2/c1-8-10-17-13(16)15(7,12(3)9-2)11-14(4,5)6/h8,12-13,16H,1,9-11H2,2-7H3 |
| InChIKey | FOJPKJHYJGFUFL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|