About 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane
1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane (PubChem CID 123148317) has the molecular formula C20H40O
and a molecular weight of 296.54 g/mol. Its IUPAC name is 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane.
Molecular Properties
| Compound Name | 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane |
| PubChem CID | 123148317 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.31 |
| IUPAC Name | 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane |
| SMILES | CCC(C)C(C)(CC(C)(C)C)C(C)OC1(CC)CCCC1 |
| InChI | InChI=1S/C20H40O/c1-9-16(3)19(8,15-18(5,6)7)17(4)21-20(10-2)13-11-12-14-20/h16-17H,9-15H2,1-8H3 |
| InChIKey | SIFZXVORILPBOJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane?
The IUPAC name of 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane (CID 123148317) is 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane.
What is the SMILES notation for 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane?
The canonical SMILES for 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane is CCC(C)C(C)(CC(C)(C)C)C(C)OC1(CC)CCCC1.
What is the InChIKey of 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane?
The InChIKey is SIFZXVORILPBOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O/c1-9-16(3)19(8,15-18(5,6)7)17(4)21-20(10-2)13-11-12-14-20/h16-17H,9-15H2,1-8H3.
What are the key properties of 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane?
1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane has a molecular weight of 296.54 g/mol, XLogP of 6.60, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-butan-2-yl-3,5,5-trimethylhexan-2-yl)oxy-1-ethylcyclopentane is sourced from PubChem (CID 123148317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).