C19H38O2 — CID 123857999
2-tert-butyl-1-(1-ethylcyclopentyl)oxy-2,4,4-trimethylpentan-1-ol (PubChem CID 123857999) has the molecular formula C19H38O2 and a molecular weight of 298.51 g/mol. Its IUPAC name is 2-tert-butyl-1-(1-ethylcyclopentyl)oxy-2,4,4-trimethylpentan-1-ol.
| Compound Name | 2-tert-butyl-1-(1-ethylcyclopentyl)oxy-2,4,4-trimethylpentan-1-ol |
|---|---|
| PubChem CID | 123857999 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | 2-tert-butyl-1-(1-ethylcyclopentyl)oxy-2,4,4-trimethylpentan-1-ol |
| SMILES | CCC1(OC(O)C(C)(CC(C)(C)C)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C19H38O2/c1-9-19(12-10-11-13-19)21-15(20)18(8,17(5,6)7)14-16(2,3)4/h15,20H,9-14H2,1-8H3 |
| InChIKey | ORSMCXLALOVIRR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|