C9H18BNO3 — CID 124770176
(3R,7R,10R)-3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo[3.3.3]undecane (PubChem CID 124770176) has the molecular formula C9H18BNO3 and a molecular weight of 199.06 g/mol. Its IUPAC name is (3R,7R,10R)-3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo[3.3.3]undecane.
| Compound Name | (3R,7R,10R)-3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 124770176 |
| Molecular Formula | C9H18BNO3 |
| Molecular Weight | 199.06 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (3R,7R,10R)-3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo[3.3.3]undecane |
| SMILES | C[C@@H]1CN2C[C@@H](C)OB(O1)O[C@H](C)C2 |
| InChI | InChI=1S/C9H18BNO3/c1-7-4-11-5-8(2)13-10(12-7)14-9(3)6-11/h7-9H,4-6H2,1-3H3/t7-,8-,9-/m1/s1 |
| InChIKey | IWKGJTDSJPLUCE-IWSPIJDZSA-N |
| XLogP | 0.52 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.06 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|