C13H20F9NO2Si — CID 140723502
2-methoxy-2,6-dimethyl-8-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-1,6,2-oxazasilocane (PubChem CID 140723502) has the molecular formula C13H20F9NO2Si and a molecular weight of 421.38 g/mol. Its IUPAC name is 2-methoxy-2,6-dimethyl-8-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-1,6,2-oxazasilocane.
| Compound Name | 2-methoxy-2,6-dimethyl-8-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-1,6,2-oxazasilocane |
|---|---|
| PubChem CID | 140723502 |
| Molecular Formula | C13H20F9NO2Si |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-methoxy-2,6-dimethyl-8-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-1,6,2-oxazasilocane |
| SMILES | CO[Si]1(C)CCCN(C)CC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C13H20F9NO2Si/c1-23-5-4-6-26(3,24-2)25-9(8-23)7-10(14,15)11(16,17)12(18,19)13(20,21)22/h9H,4-8H2,1-3H3 |
| InChIKey | DYYVWOOPGWKRFQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|