About 3-(1H-indol-2-yl)piperidine-2,2,5-triamine
3-(1H-indol-2-yl)piperidine-2,2,5-triamine (PubChem CID 151410944) has the molecular formula C13H19N5
and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-(1H-indol-2-yl)piperidine-2,2,5-triamine.
Molecular Properties
| Compound Name | 3-(1H-indol-2-yl)piperidine-2,2,5-triamine |
| PubChem CID | 151410944 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3-(1H-indol-2-yl)piperidine-2,2,5-triamine |
| SMILES | NC1CNC(N)(N)C(c2cc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C13H19N5/c14-9-6-10(13(15,16)17-7-9)12-5-8-3-1-2-4-11(8)18-12/h1-5,9-10,17-18H,6-7,14-16H2 |
| InChIKey | OYMXJYHPPYZVCT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-indol-2-yl)piperidine-2,2,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-indol-2-yl)piperidine-2,2,5-triamine?
The IUPAC name of 3-(1H-indol-2-yl)piperidine-2,2,5-triamine (CID 151410944) is 3-(1H-indol-2-yl)piperidine-2,2,5-triamine.
What is the SMILES notation for 3-(1H-indol-2-yl)piperidine-2,2,5-triamine?
The canonical SMILES for 3-(1H-indol-2-yl)piperidine-2,2,5-triamine is NC1CNC(N)(N)C(c2cc3ccccc3[nH]2)C1.
What is the InChIKey of 3-(1H-indol-2-yl)piperidine-2,2,5-triamine?
The InChIKey is OYMXJYHPPYZVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5/c14-9-6-10(13(15,16)17-7-9)12-5-8-3-1-2-4-11(8)18-12/h1-5,9-10,17-18H,6-7,14-16H2.
What are the key properties of 3-(1H-indol-2-yl)piperidine-2,2,5-triamine?
3-(1H-indol-2-yl)piperidine-2,2,5-triamine has a molecular weight of 245.33 g/mol, XLogP of 0.14, 1 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-indol-2-yl)piperidine-2,2,5-triamine is sourced from PubChem (CID 151410944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).