C19H21O3P — CID 151416779
(1-butan-2-ylanthracen-2-yl)methylphosphonic acid (PubChem CID 151416779) has the molecular formula C19H21O3P and a molecular weight of 328.35 g/mol. Its IUPAC name is (1-butan-2-ylanthracen-2-yl)methylphosphonic acid.
| Compound Name | (1-butan-2-ylanthracen-2-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 151416779 |
| Molecular Formula | C19H21O3P |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (1-butan-2-ylanthracen-2-yl)methylphosphonic acid |
| SMILES | CCC(C)c1c(CP(=O)(O)O)ccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C19H21O3P/c1-3-13(2)19-17(12-23(20,21)22)9-8-16-10-14-6-4-5-7-15(14)11-18(16)19/h4-11,13H,3,12H2,1-2H3,(H2,20,21,22) |
| InChIKey | OZRPGJMOJBIABU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|