C16H15O4P — CID 152670322
(2-ethoxyanthracen-1-yl)phosphonic acid (PubChem CID 152670322) has the molecular formula C16H15O4P and a molecular weight of 302.27 g/mol. Its IUPAC name is (2-ethoxyanthracen-1-yl)phosphonic acid.
| Compound Name | (2-ethoxyanthracen-1-yl)phosphonic acid |
|---|---|
| PubChem CID | 152670322 |
| Molecular Formula | C16H15O4P |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (2-ethoxyanthracen-1-yl)phosphonic acid |
| SMILES | CCOc1ccc2cc3ccccc3cc2c1P(=O)(O)O |
| InChI | InChI=1S/C16H15O4P/c1-2-20-15-8-7-13-9-11-5-3-4-6-12(11)10-14(13)16(15)21(17,18)19/h3-10H,2H2,1H3,(H2,17,18,19) |
| InChIKey | ZLJXGDSLMSQKJM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|