C24H32O6P2 — CID 126564288
[1-ethyl-1-[2-(3-phosphonopentan-3-yl)anthracen-1-yl]propyl]phosphonic acid (PubChem CID 126564288) has the molecular formula C24H32O6P2 and a molecular weight of 478.46 g/mol. Its IUPAC name is [1-ethyl-1-[2-(3-phosphonopentan-3-yl)anthracen-1-yl]propyl]phosphonic acid.
| Compound Name | [1-ethyl-1-[2-(3-phosphonopentan-3-yl)anthracen-1-yl]propyl]phosphonic acid |
|---|---|
| PubChem CID | 126564288 |
| Molecular Formula | C24H32O6P2 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | [1-ethyl-1-[2-(3-phosphonopentan-3-yl)anthracen-1-yl]propyl]phosphonic acid |
| SMILES | CCC(CC)(c1ccc2cc3ccccc3cc2c1C(CC)(CC)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C24H32O6P2/c1-5-23(6-2,31(25,26)27)21-14-13-19-15-17-11-9-10-12-18(17)16-20(19)22(21)24(7-3,8-4)32(28,29)30/h9-16H,5-8H2,1-4H3,(H2,25,26,27)(H2,28,29,30) |
| InChIKey | OHLKPTITYPBHSX-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|