C10H10BrNO2S — CID 15141999
4-bromo-7-ethoxy-3-methyl-1,3-benzothiazol-2-one (PubChem CID 15141999) has the molecular formula C10H10BrNO2S and a molecular weight of 288.17 g/mol. Its IUPAC name is 4-bromo-7-ethoxy-3-methyl-1,3-benzothiazol-2-one.
| Compound Name | 4-bromo-7-ethoxy-3-methyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 15141999 |
| Molecular Formula | C10H10BrNO2S |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 4-bromo-7-ethoxy-3-methyl-1,3-benzothiazol-2-one |
| SMILES | CCOc1ccc(Br)c2c1sc(=O)n2C |
| InChI | InChI=1S/C10H10BrNO2S/c1-3-14-7-5-4-6(11)8-9(7)15-10(13)12(8)2/h4-5H,3H2,1-2H3 |
| InChIKey | XGJUVZQBNMMGJM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |